C20H29ClO5 — CID 91705513
1-O-(2-chloro-4-methoxyphenyl) 3-O-hexyl 2,2-diethylpropanedioate (PubChem CID 91705513) has the molecular formula C20H29ClO5 and a molecular weight of 384.90 g/mol. Its IUPAC name is 1-O-(2-chloro-4-methoxyphenyl) 3-O-hexyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2-chloro-4-methoxyphenyl) 3-O-hexyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91705513 |
| Molecular Formula | C20H29ClO5 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-O-(2-chloro-4-methoxyphenyl) 3-O-hexyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCOC(=O)C(CC)(CC)C(=O)Oc1ccc(OC)cc1Cl |
| InChI | InChI=1S/C20H29ClO5/c1-5-8-9-10-13-25-18(22)20(6-2,7-3)19(23)26-17-12-11-15(24-4)14-16(17)21/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | IPNYZGXEOYYDAT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|