C19H26Cl2O4 — CID 91705346
1-O-(2,4-dichlorophenyl) 3-O-hexyl 2,2-diethylpropanedioate (PubChem CID 91705346) has the molecular formula C19H26Cl2O4 and a molecular weight of 389.32 g/mol. Its IUPAC name is 1-O-(2,4-dichlorophenyl) 3-O-hexyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2,4-dichlorophenyl) 3-O-hexyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91705346 |
| Molecular Formula | C19H26Cl2O4 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-O-(2,4-dichlorophenyl) 3-O-hexyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCOC(=O)C(CC)(CC)C(=O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H26Cl2O4/c1-4-7-8-9-12-24-17(22)19(5-2,6-3)18(23)25-16-11-10-14(20)13-15(16)21/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | OWIRQNLDMWSBJR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|