C21H18Cl3F4NO3 — CID 19356543
N-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butyl]-4-(trifluoromethyl)benzamide (PubChem CID 19356543) has the molecular formula C21H18Cl3F4NO3 and a molecular weight of 514.73 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 19356543 |
| Molecular Formula | C21H18Cl3F4NO3 |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | N-[4-[2-chloro-4-(3,3-dichloroprop-2-enoxy)-6-fluorophenoxy]butyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCOc1c(F)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18Cl3F4NO3/c22-16-11-15(31-10-7-18(23)24)12-17(25)19(16)32-9-2-1-8-29-20(30)13-3-5-14(6-4-13)21(26,27)28/h3-7,11-12H,1-2,8-10H2,(H,29,30) |
| InChIKey | ATLYEQDHNBWMDK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|