C23H24Cl4O4 — CID 18430231
1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]pentan-1-one (PubChem CID 18430231) has the molecular formula C23H24Cl4O4 and a molecular weight of 506.25 g/mol. Its IUPAC name is 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]pentan-1-one.
| Compound Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 18430231 |
| Molecular Formula | C23H24Cl4O4 |
| Molecular Weight | 506.25 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H24Cl4O4/c1-2-3-5-21(28)16-6-8-17(9-7-16)29-11-4-12-31-23-19(24)14-18(15-20(23)25)30-13-10-22(26)27/h6-10,14-15H,2-5,11-13H2,1H3 |
| InChIKey | BFWDWRIXJLUTBC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.25 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|