C19H19Cl4NO3S — CID 18430178
(E)-N-butoxy-1-[5-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]thiophen-2-yl]methanimine (PubChem CID 18430178) has the molecular formula C19H19Cl4NO3S and a molecular weight of 483.24 g/mol. Its IUPAC name is (E)-N-butoxy-1-[5-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]thiophen-2-yl]methanimine.
| Compound Name | (E)-N-butoxy-1-[5-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]thiophen-2-yl]methanimine |
|---|---|
| PubChem CID | 18430178 |
| Molecular Formula | C19H19Cl4NO3S |
| Molecular Weight | 483.24 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | (E)-N-butoxy-1-[5-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]thiophen-2-yl]methanimine |
| SMILES | CCCCO/N=C/c1ccc(COc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)s1 |
| InChI | InChI=1S/C19H19Cl4NO3S/c1-2-3-7-27-24-11-14-4-5-15(28-14)12-26-19-16(20)9-13(10-17(19)21)25-8-6-18(22)23/h4-6,9-11H,2-3,7-8,12H2,1H3/b24-11+ |
| InChIKey | UJPKOYFSLFLUPO-BHGWPJFGSA-N |
| XLogP | 7.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.24 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|