C23H26Cl4N2O4 — CID 54001299
N-butoxy-2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]ethanimine (PubChem CID 54001299) has the molecular formula C23H26Cl4N2O4 and a molecular weight of 536.28 g/mol. Its IUPAC name is N-butoxy-2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]ethanimine.
| Compound Name | N-butoxy-2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 54001299 |
| Molecular Formula | C23H26Cl4N2O4 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | N-butoxy-2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]ethanimine |
| SMILES | CCCCON=CCc1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C23H26Cl4N2O4/c1-2-3-12-33-29-9-7-17-5-6-22(28-16-17)31-10-4-11-32-23-19(24)14-18(15-20(23)25)30-13-8-21(26)27/h5-6,8-9,14-16H,2-4,7,10-13H2,1H3 |
| InChIKey | KLURNROYOYIARZ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|