C27H26Cl4N2O4 — CID 54181381
1-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-1-phenyl-N-propan-2-yloxymethanimine (PubChem CID 54181381) has the molecular formula C27H26Cl4N2O4 and a molecular weight of 584.33 g/mol. Its IUPAC name is 1-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-1-phenyl-N-propan-2-yloxymethanimine.
| Compound Name | 1-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-1-phenyl-N-propan-2-yloxymethanimine |
|---|---|
| PubChem CID | 54181381 |
| Molecular Formula | C27H26Cl4N2O4 |
| Molecular Weight | 584.33 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | 1-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-1-phenyl-N-propan-2-yloxymethanimine |
| SMILES | CC(C)ON=C(c1ccccc1)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C27H26Cl4N2O4/c1-18(2)37-33-26(19-7-4-3-5-8-19)20-9-10-25(32-17-20)35-12-6-13-36-27-22(28)15-21(16-23(27)29)34-14-11-24(30)31/h3-5,7-11,15-18H,6,12-14H2,1-2H3 |
| InChIKey | PCAVWBQRICBVGC-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.33 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|