C18H23Cl4NO4 — CID 173216345
4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl N-propan-2-yloxyethanimidate (PubChem CID 173216345) has the molecular formula C18H23Cl4NO4 and a molecular weight of 459.20 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl N-propan-2-yloxyethanimidate.
| Compound Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl N-propan-2-yloxyethanimidate |
|---|---|
| PubChem CID | 173216345 |
| Molecular Formula | C18H23Cl4NO4 |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl N-propan-2-yloxyethanimidate |
| SMILES | CC(=NOC(C)C)OCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C18H23Cl4NO4/c1-12(2)27-23-13(3)24-7-4-5-8-26-18-15(19)10-14(11-16(18)20)25-9-6-17(21)22/h6,10-12H,4-5,7-9H2,1-3H3 |
| InChIKey | XADHYIHKNCPRQP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|