C18H20Cl7NO4 — CID 173216392
5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentyl N-(2,2,2-trichloroethoxy)ethanimidate (PubChem CID 173216392) has the molecular formula C18H20Cl7NO4 and a molecular weight of 562.53 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentyl N-(2,2,2-trichloroethoxy)ethanimidate.
| Compound Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentyl N-(2,2,2-trichloroethoxy)ethanimidate |
|---|---|
| PubChem CID | 173216392 |
| Molecular Formula | C18H20Cl7NO4 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 558.92 |
| IUPAC Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentyl N-(2,2,2-trichloroethoxy)ethanimidate |
| SMILES | CC(=NOCC(Cl)(Cl)Cl)OCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl7NO4/c1-12(26-30-11-18(23,24)25)27-6-3-2-4-7-29-17-14(19)9-13(10-15(17)20)28-8-5-16(21)22/h5,9-10H,2-4,6-8,11H2,1H3 |
| InChIKey | ZWQZKPOQWJVIKF-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|