About 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate
6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate (PubChem CID 173216464) has the molecular formula C21H29Cl4NO4
and a molecular weight of 501.28 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate.
Molecular Properties
| Compound Name | 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| PubChem CID | 173216464 |
| Molecular Formula | C21H29Cl4NO4 |
| Molecular Weight | 501.28 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| SMILES | CC(=NOC(C)(C)C)OCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C21H29Cl4NO4/c1-15(26-30-21(2,3)4)27-10-7-5-6-8-11-29-20-17(22)13-16(14-18(20)23)28-12-9-19(24)25/h9,13-14H,5-8,10-12H2,1-4H3 |
| InChIKey | OGKKMRAWHGACQW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.28 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The IUPAC name of 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate (CID 173216464) is 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate.
What is the SMILES notation for 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The canonical SMILES for 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate is CC(=NOC(C)(C)C)OCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl.
What is the InChIKey of 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate?
The InChIKey is OGKKMRAWHGACQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29Cl4NO4/c1-15(26-30-21(2,3)4)27-10-7-5-6-8-11-29-20-17(22)13-16(14-18(20)23)28-12-9-19(24)25/h9,13-14H,5-8,10-12H2,1-4H3.
What are the key properties of 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate?
6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate has a molecular weight of 501.28 g/mol, XLogP of 7.80, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate is sourced from PubChem (CID 173216464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).