C21H29Cl4NO4 — CID 173216464
6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate (PubChem CID 173216464) has the molecular formula C21H29Cl4NO4 and a molecular weight of 501.28 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate.
| Compound Name | 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
|---|---|
| PubChem CID | 173216464 |
| Molecular Formula | C21H29Cl4NO4 |
| Molecular Weight | 501.28 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| SMILES | CC(=NOC(C)(C)C)OCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C21H29Cl4NO4/c1-15(26-30-21(2,3)4)27-10-7-5-6-8-11-29-20-17(22)13-16(14-18(20)23)28-12-9-19(24)25/h9,13-14H,5-8,10-12H2,1-4H3 |
| InChIKey | OGKKMRAWHGACQW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.28 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|