C22H20Cl6N2O4 — CID 152753016
2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-N-(3,3-dichloroprop-2-enoxy)ethanimine (PubChem CID 152753016) has the molecular formula C22H20Cl6N2O4 and a molecular weight of 589.13 g/mol. Its IUPAC name is 2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-N-(3,3-dichloroprop-2-enoxy)ethanimine.
| Compound Name | 2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-N-(3,3-dichloroprop-2-enoxy)ethanimine |
|---|---|
| PubChem CID | 152753016 |
| Molecular Formula | C22H20Cl6N2O4 |
| Molecular Weight | 589.13 g/mol |
| Exact Mass | 585.96 |
| IUPAC Name | 2-[6-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]-3-pyridinyl]-N-(3,3-dichloroprop-2-enoxy)ethanimine |
| SMILES | ClC(Cl)=CCON=CCc1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C22H20Cl6N2O4/c23-17-12-16(31-10-5-19(25)26)13-18(24)22(17)33-9-1-8-32-21-3-2-15(14-29-21)4-7-30-34-11-6-20(27)28/h2-3,5-7,12-14H,1,4,8-11H2 |
| InChIKey | FMKLWHLYMHXCQW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.13 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|