C28H24Cl4N2O8 — CID 141447469
1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-4-nitro-3-(4-nitrophenyl)butan-1-one (PubChem CID 141447469) has the molecular formula C28H24Cl4N2O8 and a molecular weight of 658.32 g/mol. Its IUPAC name is 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-4-nitro-3-(4-nitrophenyl)butan-1-one.
| Compound Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-4-nitro-3-(4-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 141447469 |
| Molecular Formula | C28H24Cl4N2O8 |
| Molecular Weight | 658.32 g/mol |
| Exact Mass | 656.03 |
| IUPAC Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-4-nitro-3-(4-nitrophenyl)butan-1-one |
| SMILES | O=C(CC(C[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H24Cl4N2O8/c29-24-15-23(41-13-10-27(31)32)16-25(30)28(24)42-12-1-11-40-22-8-4-19(5-9-22)26(35)14-20(17-33(36)37)18-2-6-21(7-3-18)34(38)39/h2-10,15-16,20H,1,11-14,17H2 |
| InChIKey | AKGJRKDJIYPDBG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.32 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|