C24H25Cl4NO4 — CID 139747652
[3-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-piperidin-1-ylmethanone (PubChem CID 139747652) has the molecular formula C24H25Cl4NO4 and a molecular weight of 533.28 g/mol. Its IUPAC name is [3-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 139747652 |
| Molecular Formula | C24H25Cl4NO4 |
| Molecular Weight | 533.28 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | [3-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H25Cl4NO4/c25-20-15-19(32-13-8-22(27)28)16-21(26)23(20)33-12-5-11-31-18-7-4-6-17(14-18)24(30)29-9-2-1-3-10-29/h4,6-8,14-16H,1-3,5,9-13H2 |
| InChIKey | JKCQYXXZTAPKIH-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.28 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|