C18H21Cl4NO3 — CID 19356542
4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-piperidin-1-ylbutan-1-one (PubChem CID 19356542) has the molecular formula C18H21Cl4NO3 and a molecular weight of 441.18 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 19356542 |
| Molecular Formula | C18H21Cl4NO3 |
| Molecular Weight | 441.18 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-piperidin-1-ylbutan-1-one |
| SMILES | O=C(CCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C18H21Cl4NO3/c19-14-11-13(25-10-6-16(21)22)12-15(20)18(14)26-9-4-5-17(24)23-7-2-1-3-8-23/h6,11-12H,1-5,7-10H2 |
| InChIKey | KYBCLQXOEOLDMQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.18 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|