About S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate
S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate (PubChem CID 101436510) has the molecular formula C17H16N2O6S
and a molecular weight of 376.39 g/mol. Its IUPAC name is S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate.
Molecular Properties
| Compound Name | S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate |
| PubChem CID | 101436510 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate |
| SMILES | COc1ccc(SC(=O)C[C@@H](C[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H16N2O6S/c1-25-15-6-8-16(9-7-15)26-17(20)10-13(11-18(21)22)12-2-4-14(5-3-12)19(23)24/h2-9,13H,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | XDKHVELONFHJOI-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate?
The IUPAC name of S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate (CID 101436510) is S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate.
What is the SMILES notation for S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate?
The canonical SMILES for S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate is COc1ccc(SC(=O)C[C@@H](C[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate?
The InChIKey is XDKHVELONFHJOI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H16N2O6S/c1-25-15-6-8-16(9-7-15)26-17(20)10-13(11-18(21)22)12-2-4-14(5-3-12)19(23)24/h2-9,13H,10-11H2,1H3/t13-/m0/s1.
What are the key properties of S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate?
S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate has a molecular weight of 376.39 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methoxyphenyl) (3R)-4-nitro-3-(4-nitrophenyl)butanethioate is sourced from PubChem (CID 101436510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).