C20H20Cl2F3NO5 — CID 139730213
2-[3-[4-(3,3-dichloroprop-2-enoxy)-3,5-dimethoxyphenoxy]propoxy]-5-(trifluoromethyl)pyridine (PubChem CID 139730213) has the molecular formula C20H20Cl2F3NO5 and a molecular weight of 482.28 g/mol. Its IUPAC name is 2-[3-[4-(3,3-dichloroprop-2-enoxy)-3,5-dimethoxyphenoxy]propoxy]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[3-[4-(3,3-dichloroprop-2-enoxy)-3,5-dimethoxyphenoxy]propoxy]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 139730213 |
| Molecular Formula | C20H20Cl2F3NO5 |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 2-[3-[4-(3,3-dichloroprop-2-enoxy)-3,5-dimethoxyphenoxy]propoxy]-5-(trifluoromethyl)pyridine |
| SMILES | COc1cc(OCCCOc2ccc(C(F)(F)F)cn2)cc(OC)c1OCC=C(Cl)Cl |
| InChI | InChI=1S/C20H20Cl2F3NO5/c1-27-15-10-14(11-16(28-2)19(15)31-9-6-17(21)22)29-7-3-8-30-18-5-4-13(12-26-18)20(23,24)25/h4-6,10-12H,3,7-9H2,1-2H3 |
| InChIKey | VJUNIKMAZSFLNZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|