C20H15Cl6NO4 — CID 19356597
[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenyl] 4-[(2,5-dichlorobenzoyl)amino]butanoate (PubChem CID 19356597) has the molecular formula C20H15Cl6NO4 and a molecular weight of 546.06 g/mol. Its IUPAC name is [2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenyl] 4-[(2,5-dichlorobenzoyl)amino]butanoate.
| Compound Name | [2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenyl] 4-[(2,5-dichlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 19356597 |
| Molecular Formula | C20H15Cl6NO4 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 542.91 |
| IUPAC Name | [2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenyl] 4-[(2,5-dichlorobenzoyl)amino]butanoate |
| SMILES | O=C(CCCNC(=O)c1cc(Cl)ccc1Cl)Oc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl6NO4/c21-11-3-4-14(22)13(8-11)20(29)27-6-1-2-18(28)31-19-15(23)9-12(10-16(19)24)30-7-5-17(25)26/h3-5,8-10H,1-2,6-7H2,(H,27,29) |
| InChIKey | BRTZSQHGRQJTHE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|