C17H16Cl4N2O2 — CID 139724919
N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]pyridin-2-amine (PubChem CID 139724919) has the molecular formula C17H16Cl4N2O2 and a molecular weight of 422.14 g/mol. Its IUPAC name is N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]pyridin-2-amine.
| Compound Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 139724919 |
| Molecular Formula | C17H16Cl4N2O2 |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]pyridin-2-amine |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCNc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl4N2O2/c18-13-10-12(24-9-5-15(20)21)11-14(19)17(13)25-8-3-7-23-16-4-1-2-6-22-16/h1-2,4-6,10-11H,3,7-9H2,(H,22,23) |
| InChIKey | FWOVVBCSOJFVLK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|