C17H12Cl4O3 — CID 18429639
4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]benzaldehyde (PubChem CID 18429639) has the molecular formula C17H12Cl4O3 and a molecular weight of 406.09 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]benzaldehyde.
| Compound Name | 4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]benzaldehyde |
|---|---|
| PubChem CID | 18429639 |
| Molecular Formula | C17H12Cl4O3 |
| Molecular Weight | 406.09 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(COc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H12Cl4O3/c18-14-7-13(23-6-5-16(20)21)8-15(19)17(14)24-10-12-3-1-11(9-22)2-4-12/h1-5,7-9H,6,10H2 |
| InChIKey | LKVCQOBIHIONEM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.09 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|