C20H19Cl4NO3 — CID 18429789
(E)-1-[4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-propan-2-yloxymethanimine (PubChem CID 18429789) has the molecular formula C20H19Cl4NO3 and a molecular weight of 463.19 g/mol. Its IUPAC name is (E)-1-[4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-propan-2-yloxymethanimine.
| Compound Name | (E)-1-[4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-propan-2-yloxymethanimine |
|---|---|
| PubChem CID | 18429789 |
| Molecular Formula | C20H19Cl4NO3 |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | (E)-1-[4-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-propan-2-yloxymethanimine |
| SMILES | CC(C)O/N=C/c1ccc(COc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H19Cl4NO3/c1-13(2)28-25-11-14-3-5-15(6-4-14)12-27-20-17(21)9-16(10-18(20)22)26-8-7-19(23)24/h3-7,9-11,13H,8,12H2,1-2H3/b25-11+ |
| InChIKey | PPFYQRPDUDOLTD-OPEKNORGSA-N |
| XLogP | 7.03 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|