C24H19Cl4NO3 — CID 18430188
(E)-1-[3-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-phenylmethoxymethanimine (PubChem CID 18430188) has the molecular formula C24H19Cl4NO3 and a molecular weight of 511.23 g/mol. Its IUPAC name is (E)-1-[3-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-phenylmethoxymethanimine.
| Compound Name | (E)-1-[3-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 18430188 |
| Molecular Formula | C24H19Cl4NO3 |
| Molecular Weight | 511.23 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | (E)-1-[3-[[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-N-phenylmethoxymethanimine |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCc2cccc(/C=N/OCc3ccccc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl4NO3/c25-21-12-20(30-10-9-23(27)28)13-22(26)24(21)31-15-19-8-4-7-18(11-19)14-29-32-16-17-5-2-1-3-6-17/h1-9,11-14H,10,15-16H2/b29-14+ |
| InChIKey | ONJZLJLNPWWYRP-IPPBACCNSA-N |
| XLogP | 7.82 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.23 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|