C18H20F3NO3 — CID 18504580
3-ethyl-5-methyl-4-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]phenol (PubChem CID 18504580) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-ethyl-5-methyl-4-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]phenol.
| Compound Name | 3-ethyl-5-methyl-4-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]phenol |
|---|---|
| PubChem CID | 18504580 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-ethyl-5-methyl-4-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]phenol |
| SMILES | CCc1cc(O)cc(C)c1OCCCOc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H20F3NO3/c1-3-13-10-15(23)9-12(2)17(13)25-8-4-7-24-16-6-5-14(11-22-16)18(19,20)21/h5-6,9-11,23H,3-4,7-8H2,1-2H3 |
| InChIKey | YTMRNUXCHREJMB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|