C20H22F3NO3 — CID 174394385
N-[3-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-2-(trifluoromethyl)benzamide (PubChem CID 174394385) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[3-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174394385 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[3-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCc1cc(O)cc(C)c1OCCCNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H22F3NO3/c1-3-14-12-15(25)11-13(2)18(14)27-10-6-9-24-19(26)16-7-4-5-8-17(16)20(21,22)23/h4-5,7-8,11-12,25H,3,6,9-10H2,1-2H3,(H,24,26) |
| InChIKey | VCQBORJCTFCBSI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|