C11H11F6NO2 — CID 88561399
1,1,1,3,3,3-hexafluoro-2-(6-propoxy-3-pyridinyl)propan-2-ol (PubChem CID 88561399) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(6-propoxy-3-pyridinyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(6-propoxy-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 88561399 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(6-propoxy-3-pyridinyl)propan-2-ol |
| SMILES | CCCOc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H11F6NO2/c1-2-5-20-8-4-3-7(6-18-8)9(19,10(12,13)14)11(15,16)17/h3-4,6,19H,2,5H2,1H3 |
| InChIKey | PZDRLFQGIZXSIS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |