C19H29Cl5O3 — CID 142965261
3-[2-chloro-4-[(E)-3-chlorobut-2-enoxy]-6-methylphenoxy]propan-1-ol;methane;1,1,1-trichlorobutane (PubChem CID 142965261) has the molecular formula C19H29Cl5O3 and a molecular weight of 482.70 g/mol. Its IUPAC name is 3-[2-chloro-4-[(E)-3-chlorobut-2-enoxy]-6-methylphenoxy]propan-1-ol;methane;1,1,1-trichlorobutane.
| Compound Name | 3-[2-chloro-4-[(E)-3-chlorobut-2-enoxy]-6-methylphenoxy]propan-1-ol;methane;1,1,1-trichlorobutane |
|---|---|
| PubChem CID | 142965261 |
| Molecular Formula | C19H29Cl5O3 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 3-[2-chloro-4-[(E)-3-chlorobut-2-enoxy]-6-methylphenoxy]propan-1-ol;methane;1,1,1-trichlorobutane |
| SMILES | C.C/C(Cl)=C\COc1cc(C)c(OCCCO)c(Cl)c1.CCCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl2O3.C4H7Cl3.CH4/c1-10-8-12(18-7-4-11(2)15)9-13(16)14(10)19-6-3-5-17;1-2-3-4(5,6)7;/h4,8-9,17H,3,5-7H2,1-2H3;2-3H2,1H3;1H4/b11-4+;; |
| InChIKey | ACZLJGNTDZCQIO-QKBHCULISA-N |
| XLogP | 7.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|