C17H17Cl2F3N2O2 — CID 70269952
3,5-dichloro-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenol (PubChem CID 70269952) has the molecular formula C17H17Cl2F3N2O2 and a molecular weight of 409.24 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenol.
| Compound Name | 3,5-dichloro-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenol |
|---|---|
| PubChem CID | 70269952 |
| Molecular Formula | C17H17Cl2F3N2O2 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3,5-dichloro-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCCCCNCc2ccc(C(F)(F)F)cn2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2F3N2O2/c18-14-7-13(25)8-15(19)16(14)26-6-2-1-5-23-10-12-4-3-11(9-24-12)17(20,21)22/h3-4,7-9,23,25H,1-2,5-6,10H2 |
| InChIKey | ZTUPWXDOINYWNQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|