C21H25ClF3N3O3 — CID 67647214
(2S)-2-amino-3-[3-chloro-5-methyl-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenyl]propanoic acid (PubChem CID 67647214) has the molecular formula C21H25ClF3N3O3 and a molecular weight of 459.90 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-chloro-5-methyl-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-chloro-5-methyl-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67647214 |
| Molecular Formula | C21H25ClF3N3O3 |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (2S)-2-amino-3-[3-chloro-5-methyl-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]methylamino]butoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(C[C@H](N)C(=O)O)cc(Cl)c1OCCCCNCc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H25ClF3N3O3/c1-13-8-14(10-18(26)20(29)30)9-17(22)19(13)31-7-3-2-6-27-12-16-5-4-15(11-28-16)21(23,24)25/h4-5,8-9,11,18,27H,2-3,6-7,10,12,26H2,1H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | LHZUQWCHQFRAQH-SFHVURJKSA-N |
| XLogP | 3.97 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|