C34H49ClFNO3 — CID 54041260
(2S)-4-[[2-chloro-4-(5-decyl-2-pyridinyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid (PubChem CID 54041260) has the molecular formula C34H49ClFNO3 and a molecular weight of 574.22 g/mol. Its IUPAC name is (2S)-4-[[2-chloro-4-(5-decyl-2-pyridinyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid.
| Compound Name | (2S)-4-[[2-chloro-4-(5-decyl-2-pyridinyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid |
|---|---|
| PubChem CID | 54041260 |
| Molecular Formula | C34H49ClFNO3 |
| Molecular Weight | 574.22 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | (2S)-4-[[2-chloro-4-(5-decyl-2-pyridinyl)phenoxy]methyl]-2-cyclohexyl-2-fluorohexanoic acid |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(OCC(CC)C[C@@](F)(C(=O)O)C3CCCCC3)c(Cl)c2)nc1 |
| InChI | InChI=1S/C34H49ClFNO3/c1-3-5-6-7-8-9-10-12-15-27-18-20-31(37-24-27)28-19-21-32(30(35)22-28)40-25-26(4-2)23-34(36,33(38)39)29-16-13-11-14-17-29/h18-22,24,26,29H,3-17,23,25H2,1-2H3,(H,38,39)/t26?,34-/m0/s1 |
| InChIKey | LMNBOXLDRMHPBU-BFZOCEIISA-N |
| XLogP | 10.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.22 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|