C18H19ClFNO4 — CID 121447327
4-[2-chloro-6-fluoro-4-(6-propan-2-yloxy-2-pyridinyl)phenoxy]butanoic acid (PubChem CID 121447327) has the molecular formula C18H19ClFNO4 and a molecular weight of 367.80 g/mol. Its IUPAC name is 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxy-2-pyridinyl)phenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxy-2-pyridinyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447327 |
| Molecular Formula | C18H19ClFNO4 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxy-2-pyridinyl)phenoxy]butanoic acid |
| SMILES | CC(C)Oc1cccc(-c2cc(F)c(OCCCC(=O)O)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H19ClFNO4/c1-11(2)25-16-6-3-5-15(21-16)12-9-13(19)18(14(20)10-12)24-8-4-7-17(22)23/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,22,23) |
| InChIKey | JKBLOYYEEWGIDL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|