C20H21ClFNO4 — CID 121447192
4-[2-chloro-4-(6-cyclopentyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid (PubChem CID 121447192) has the molecular formula C20H21ClFNO4 and a molecular weight of 393.84 g/mol. Its IUPAC name is 4-[2-chloro-4-(6-cyclopentyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-4-(6-cyclopentyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447192 |
| Molecular Formula | C20H21ClFNO4 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-[2-chloro-4-(6-cyclopentyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(F)cc(-c2cccc(OC3CCCC3)n2)cc1Cl |
| InChI | InChI=1S/C20H21ClFNO4/c21-15-11-13(12-16(22)20(15)26-10-4-9-19(24)25)17-7-3-8-18(23-17)27-14-5-1-2-6-14/h3,7-8,11-12,14H,1-2,4-6,9-10H2,(H,24,25) |
| InChIKey | KLWKMEWINHZYJA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|