C19H19ClFNO4 — CID 121447330
4-[2-chloro-4-(6-cyclobutyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid (PubChem CID 121447330) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is 4-[2-chloro-4-(6-cyclobutyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-4-(6-cyclobutyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447330 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-[2-chloro-4-(6-cyclobutyloxy-2-pyridinyl)-6-fluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(F)cc(-c2cccc(OC3CCC3)n2)cc1Cl |
| InChI | InChI=1S/C19H19ClFNO4/c20-14-10-12(11-15(21)19(14)25-9-3-8-18(23)24)16-6-2-7-17(22-16)26-13-4-1-5-13/h2,6-7,10-11,13H,1,3-5,8-9H2,(H,23,24) |
| InChIKey | FZOATLTZUQOZSJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|