C19H18ClF2NO4 — CID 121447182
4-[4-(6-chloro-4-cyclobutyloxy-2-pyridinyl)-2,6-difluorophenoxy]butanoic acid (PubChem CID 121447182) has the molecular formula C19H18ClF2NO4 and a molecular weight of 397.81 g/mol. Its IUPAC name is 4-[4-(6-chloro-4-cyclobutyloxy-2-pyridinyl)-2,6-difluorophenoxy]butanoic acid.
| Compound Name | 4-[4-(6-chloro-4-cyclobutyloxy-2-pyridinyl)-2,6-difluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447182 |
| Molecular Formula | C19H18ClF2NO4 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-[4-(6-chloro-4-cyclobutyloxy-2-pyridinyl)-2,6-difluorophenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1c(F)cc(-c2cc(OC3CCC3)cc(Cl)n2)cc1F |
| InChI | InChI=1S/C19H18ClF2NO4/c20-17-10-13(27-12-3-1-4-12)9-16(23-17)11-7-14(21)19(15(22)8-11)26-6-2-5-18(24)25/h7-10,12H,1-6H2,(H,24,25) |
| InChIKey | XHBWLBUVRCFWFR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|