C23H22ClNO3 — CID 10386030
6-[[4-(2-chlorophenyl)-6-phenyl-2-pyridinyl]oxy]hexanoic acid (PubChem CID 10386030) has the molecular formula C23H22ClNO3 and a molecular weight of 395.89 g/mol. Its IUPAC name is 6-[[4-(2-chlorophenyl)-6-phenyl-2-pyridinyl]oxy]hexanoic acid.
| Compound Name | 6-[[4-(2-chlorophenyl)-6-phenyl-2-pyridinyl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 10386030 |
| Molecular Formula | C23H22ClNO3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-[[4-(2-chlorophenyl)-6-phenyl-2-pyridinyl]oxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc(-c2ccccc2Cl)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22ClNO3/c24-20-12-7-6-11-19(20)18-15-21(17-9-3-1-4-10-17)25-22(16-18)28-14-8-2-5-13-23(26)27/h1,3-4,6-7,9-12,15-16H,2,5,8,13-14H2,(H,26,27) |
| InChIKey | HHLWAWRHPDQPLH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|