C17H18ClFN2O4 — CID 121447359
4-[2-chloro-6-fluoro-4-(6-propan-2-yloxypyrazin-2-yl)phenoxy]butanoic acid (PubChem CID 121447359) has the molecular formula C17H18ClFN2O4 and a molecular weight of 368.79 g/mol. Its IUPAC name is 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxypyrazin-2-yl)phenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxypyrazin-2-yl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447359 |
| Molecular Formula | C17H18ClFN2O4 |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[2-chloro-6-fluoro-4-(6-propan-2-yloxypyrazin-2-yl)phenoxy]butanoic acid |
| SMILES | CC(C)Oc1cncc(-c2cc(F)c(OCCCC(=O)O)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H18ClFN2O4/c1-10(2)25-15-9-20-8-14(21-15)11-6-12(18)17(13(19)7-11)24-5-3-4-16(22)23/h6-10H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | VQYZVCNWZWSCQP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|