C25H24FNO3 — CID 118326658
4-[4-[[2-(6-cyclopropyl-3-pyridinyl)-5-fluorophenyl]methoxy]phenyl]butanoic acid (PubChem CID 118326658) has the molecular formula C25H24FNO3 and a molecular weight of 405.47 g/mol. Its IUPAC name is 4-[4-[[2-(6-cyclopropyl-3-pyridinyl)-5-fluorophenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-[4-[[2-(6-cyclopropyl-3-pyridinyl)-5-fluorophenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 118326658 |
| Molecular Formula | C25H24FNO3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[4-[[2-(6-cyclopropyl-3-pyridinyl)-5-fluorophenyl]methoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(OCc2cc(F)ccc2-c2ccc(C3CC3)nc2)cc1 |
| InChI | InChI=1S/C25H24FNO3/c26-21-9-12-23(19-8-13-24(27-15-19)18-6-7-18)20(14-21)16-30-22-10-4-17(5-11-22)2-1-3-25(28)29/h4-5,8-15,18H,1-3,6-7,16H2,(H,28,29) |
| InChIKey | LHNNFIINCAAQOK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |