C26H26FNO4 — CID 118326577
ethyl 3-[4-[[5-fluoro-2-[6-(oxetan-3-yl)-3-pyridinyl]phenyl]methoxy]phenyl]propanoate (PubChem CID 118326577) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is ethyl 3-[4-[[5-fluoro-2-[6-(oxetan-3-yl)-3-pyridinyl]phenyl]methoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[[5-fluoro-2-[6-(oxetan-3-yl)-3-pyridinyl]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 118326577 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | ethyl 3-[4-[[5-fluoro-2-[6-(oxetan-3-yl)-3-pyridinyl]phenyl]methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2cc(F)ccc2-c2ccc(C3COC3)nc2)cc1 |
| InChI | InChI=1S/C26H26FNO4/c1-2-31-26(29)12-5-18-3-8-23(9-4-18)32-17-20-13-22(27)7-10-24(20)19-6-11-25(28-14-19)21-15-30-16-21/h3-4,6-11,13-14,21H,2,5,12,15-17H2,1H3 |
| InChIKey | NTTQRGBSKMRLMI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |