C26H22FNO3 — CID 118326643
3-[4-[[2-[4-(1-cyanocyclopropyl)phenyl]-5-fluorophenyl]methoxy]phenyl]propanoic acid (PubChem CID 118326643) has the molecular formula C26H22FNO3 and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-[4-[[2-[4-(1-cyanocyclopropyl)phenyl]-5-fluorophenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-[4-(1-cyanocyclopropyl)phenyl]-5-fluorophenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118326643 |
| Molecular Formula | C26H22FNO3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-[4-[[2-[4-(1-cyanocyclopropyl)phenyl]-5-fluorophenyl]methoxy]phenyl]propanoic acid |
| SMILES | N#CC1(c2ccc(-c3ccc(F)cc3COc3ccc(CCC(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H22FNO3/c27-22-8-11-24(19-4-6-21(7-5-19)26(17-28)13-14-26)20(15-22)16-31-23-9-1-18(2-10-23)3-12-25(29)30/h1-2,4-11,15H,3,12-14,16H2,(H,29,30) |
| InChIKey | WNBKMSADWWVPOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |