C21H21NO3 — CID 166374802
3-[3-[4-(4-cyanooxan-4-yl)phenyl]phenyl]propanoic acid (PubChem CID 166374802) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-[3-[4-(4-cyanooxan-4-yl)phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[4-(4-cyanooxan-4-yl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 166374802 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[3-[4-(4-cyanooxan-4-yl)phenyl]phenyl]propanoic acid |
| SMILES | N#CC1(c2ccc(-c3cccc(CCC(=O)O)c3)cc2)CCOCC1 |
| InChI | InChI=1S/C21H21NO3/c22-15-21(10-12-25-13-11-21)19-7-5-17(6-8-19)18-3-1-2-16(14-18)4-9-20(23)24/h1-3,5-8,14H,4,9-13H2,(H,23,24) |
| InChIKey | BVNSXUAALLCEPA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |