C19H21CsN2O4 — CID 153371038
cesium;acetamide;3-[3-[4-[(oxomethylamino)methyl]phenyl]phenyl]propanoic acid (PubChem CID 153371038) has the molecular formula C19H21CsN2O4 and a molecular weight of 474.29 g/mol. Its IUPAC name is cesium;acetamide;3-[3-[4-[(oxomethylamino)methyl]phenyl]phenyl]propanoic acid.
| Compound Name | cesium;acetamide;3-[3-[4-[(oxomethylamino)methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 153371038 |
| Molecular Formula | C19H21CsN2O4 |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | cesium;acetamide;3-[3-[4-[(oxomethylamino)methyl]phenyl]phenyl]propanoic acid |
| SMILES | CC(N)=O.O=[C-]NCc1ccc(-c2cccc(CCC(=O)O)c2)cc1.[Cs+] |
| InChI | InChI=1S/C17H16NO3.C2H5NO.Cs/c19-12-18-11-14-4-7-15(8-5-14)16-3-1-2-13(10-16)6-9-17(20)21;1-2(3)4;/h1-5,7-8,10H,6,9,11H2,(H,18,19)(H,20,21);1H3,(H2,3,4);/q-1;;+1 |
| InChIKey | DPESQWMRVXQWOE-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|