C21H20N2O2 — CID 68769332
3-[3-[4-(4-aminophenyl)anilino]phenyl]propanoic acid (PubChem CID 68769332) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[3-[4-(4-aminophenyl)anilino]phenyl]propanoic acid.
| Compound Name | 3-[3-[4-(4-aminophenyl)anilino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68769332 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[3-[4-(4-aminophenyl)anilino]phenyl]propanoic acid |
| SMILES | Nc1ccc(-c2ccc(Nc3cccc(CCC(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O2/c22-18-9-5-16(6-10-18)17-7-11-19(12-8-17)23-20-3-1-2-15(14-20)4-13-21(24)25/h1-3,5-12,14,23H,4,13,22H2,(H,24,25) |
| InChIKey | BIRBRUSPYORMJD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|