C20H23FO3 — CID 130351126
ethyl 3-[4-[[4-(1-fluoroethyl)phenyl]methoxy]phenyl]propanoate (PubChem CID 130351126) has the molecular formula C20H23FO3 and a molecular weight of 330.40 g/mol. Its IUPAC name is ethyl 3-[4-[[4-(1-fluoroethyl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[[4-(1-fluoroethyl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 130351126 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl 3-[4-[[4-(1-fluoroethyl)phenyl]methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2ccc(C(C)F)cc2)cc1 |
| InChI | InChI=1S/C20H23FO3/c1-3-23-20(22)13-8-16-6-11-19(12-7-16)24-14-17-4-9-18(10-5-17)15(2)21/h4-7,9-12,15H,3,8,13-14H2,1-2H3 |
| InChIKey | GSTBKUGMDRAVGK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |