C23H26O4 — CID 144781228
ethyl 3-[4-[(2R)-2-(cyclodecapentaenyl)-2-hydroxyethoxy]phenyl]propanoate (PubChem CID 144781228) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl 3-[4-[(2R)-2-(cyclodecapentaenyl)-2-hydroxyethoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[(2R)-2-(cyclodecapentaenyl)-2-hydroxyethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 144781228 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl 3-[4-[(2R)-2-(cyclodecapentaenyl)-2-hydroxyethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OC[C@H](O)c2ccccccccc2)cc1 |
| InChI | InChI=1S/C23H26O4/c1-2-26-23(25)17-14-19-12-15-21(16-13-19)27-18-22(24)20-10-8-6-4-3-5-7-9-11-20/h3-13,15-16,22,24H,2,14,17-18H2,1H3/b4-3-,5-3-,6-4-,7-5+,8-6+,9-7+,10-8+,11-9-,20-10+,20-11+/t22-/m0/s1 |
| InChIKey | HXRBPDOJSPILJY-POKYOBTOSA-N |
| XLogP | 4.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |