C24H25FN2O4 — CID 118326568
ethyl 4-[5-[[5-fluoro-2-(6-methoxy-3-pyridinyl)phenyl]methoxy]-2-pyridinyl]butanoate (PubChem CID 118326568) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is ethyl 4-[5-[[5-fluoro-2-(6-methoxy-3-pyridinyl)phenyl]methoxy]-2-pyridinyl]butanoate.
| Compound Name | ethyl 4-[5-[[5-fluoro-2-(6-methoxy-3-pyridinyl)phenyl]methoxy]-2-pyridinyl]butanoate |
|---|---|
| PubChem CID | 118326568 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl 4-[5-[[5-fluoro-2-(6-methoxy-3-pyridinyl)phenyl]methoxy]-2-pyridinyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(OCc2cc(F)ccc2-c2ccc(OC)nc2)cn1 |
| InChI | InChI=1S/C24H25FN2O4/c1-3-30-24(28)6-4-5-20-9-10-21(15-26-20)31-16-18-13-19(25)8-11-22(18)17-7-12-23(29-2)27-14-17/h7-15H,3-6,16H2,1-2H3 |
| InChIKey | INSDVEWBTHTQMK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |