C24H23FO3S — CID 123340790
4-[4-[[2-fluoro-6-(4-methylsulfanylphenyl)phenyl]methoxy]phenyl]butanoic acid (PubChem CID 123340790) has the molecular formula C24H23FO3S and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[4-[[2-fluoro-6-(4-methylsulfanylphenyl)phenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-[4-[[2-fluoro-6-(4-methylsulfanylphenyl)phenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 123340790 |
| Molecular Formula | C24H23FO3S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-[4-[[2-fluoro-6-(4-methylsulfanylphenyl)phenyl]methoxy]phenyl]butanoic acid |
| SMILES | CSc1ccc(-c2cccc(F)c2COc2ccc(CCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H23FO3S/c1-29-20-14-10-18(11-15-20)21-5-3-6-23(25)22(21)16-28-19-12-8-17(9-13-19)4-2-7-24(26)27/h3,5-6,8-15H,2,4,7,16H2,1H3,(H,26,27) |
| InChIKey | MICKMFDBZWZEBV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |