C24H28O3 — CID 118679788
4-[4-[[2-(2-methylphenyl)cyclohexen-1-yl]methoxy]phenyl]butanoic acid (PubChem CID 118679788) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[4-[[2-(2-methylphenyl)cyclohexen-1-yl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-[4-[[2-(2-methylphenyl)cyclohexen-1-yl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 118679788 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-[4-[[2-(2-methylphenyl)cyclohexen-1-yl]methoxy]phenyl]butanoic acid |
| SMILES | Cc1ccccc1C1=C(COc2ccc(CCCC(=O)O)cc2)CCCC1 |
| InChI | InChI=1S/C24H28O3/c1-18-7-2-4-10-22(18)23-11-5-3-9-20(23)17-27-21-15-13-19(14-16-21)8-6-12-24(25)26/h2,4,7,10,13-16H,3,5-6,8-9,11-12,17H2,1H3,(H,25,26) |
| InChIKey | CREGCENRLVEAHK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |