C27H30ClFO3 — CID 139480000
3-[4-[[2-(2-chlorophenyl)cyclopenten-1-yl]methoxy]-2-(3-fluoro-2-methylpent-1-en-3-yl)phenyl]propanoic acid (PubChem CID 139480000) has the molecular formula C27H30ClFO3 and a molecular weight of 456.99 g/mol. Its IUPAC name is 3-[4-[[2-(2-chlorophenyl)cyclopenten-1-yl]methoxy]-2-(3-fluoro-2-methylpent-1-en-3-yl)phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(2-chlorophenyl)cyclopenten-1-yl]methoxy]-2-(3-fluoro-2-methylpent-1-en-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139480000 |
| Molecular Formula | C27H30ClFO3 |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-[4-[[2-(2-chlorophenyl)cyclopenten-1-yl]methoxy]-2-(3-fluoro-2-methylpent-1-en-3-yl)phenyl]propanoic acid |
| SMILES | C=C(C)C(F)(CC)c1cc(OCC2=C(c3ccccc3Cl)CCC2)ccc1CCC(=O)O |
| InChI | InChI=1S/C27H30ClFO3/c1-4-27(29,18(2)3)24-16-21(14-12-19(24)13-15-26(30)31)32-17-20-8-7-10-22(20)23-9-5-6-11-25(23)28/h5-6,9,11-12,14,16H,2,4,7-8,10,13,15,17H2,1,3H3,(H,30,31) |
| InChIKey | BEMYMDLLTCVGBQ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|