C19H23ClO3 — CID 139480430
3-[2-chloro-4-[(2-cyclobutylcyclopenten-1-yl)methoxy]phenyl]propanoic acid (PubChem CID 139480430) has the molecular formula C19H23ClO3 and a molecular weight of 334.84 g/mol. Its IUPAC name is 3-[2-chloro-4-[(2-cyclobutylcyclopenten-1-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-chloro-4-[(2-cyclobutylcyclopenten-1-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139480430 |
| Molecular Formula | C19H23ClO3 |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[2-chloro-4-[(2-cyclobutylcyclopenten-1-yl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC2=C(C3CCC3)CCC2)cc1Cl |
| InChI | InChI=1S/C19H23ClO3/c20-18-11-16(9-7-14(18)8-10-19(21)22)23-12-15-5-2-6-17(15)13-3-1-4-13/h7,9,11,13H,1-6,8,10,12H2,(H,21,22) |
| InChIKey | BYCIGLWRVFNHFY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|