C19H23FO3 — CID 139480316
3-[4-[(2-cyclopropylcyclopenten-1-yl)methoxy]-5-fluoro-2-methylphenyl]propanoic acid (PubChem CID 139480316) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is 3-[4-[(2-cyclopropylcyclopenten-1-yl)methoxy]-5-fluoro-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(2-cyclopropylcyclopenten-1-yl)methoxy]-5-fluoro-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 139480316 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[4-[(2-cyclopropylcyclopenten-1-yl)methoxy]-5-fluoro-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(OCC2=C(C3CC3)CCC2)c(F)cc1CCC(=O)O |
| InChI | InChI=1S/C19H23FO3/c1-12-9-18(17(20)10-14(12)7-8-19(21)22)23-11-15-3-2-4-16(15)13-5-6-13/h9-10,13H,2-8,11H2,1H3,(H,21,22) |
| InChIKey | WLEXWFYTYDJDOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|