C22H22F2O3 — CID 139480362
3-[5-fluoro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]-2-methylphenyl]propanoic acid (PubChem CID 139480362) has the molecular formula C22H22F2O3 and a molecular weight of 372.41 g/mol. Its IUPAC name is 3-[5-fluoro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[5-fluoro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 139480362 |
| Molecular Formula | C22H22F2O3 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[5-fluoro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(OCC2=C(c3ccc(F)cc3)CCC2)c(F)cc1CCC(=O)O |
| InChI | InChI=1S/C22H22F2O3/c1-14-11-21(20(24)12-16(14)7-10-22(25)26)27-13-17-3-2-4-19(17)15-5-8-18(23)9-6-15/h5-6,8-9,11-12H,2-4,7,10,13H2,1H3,(H,25,26) |
| InChIKey | BSAOULWGSSLKAL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |