C21H20ClFO3 — CID 139480419
3-[2-chloro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]phenyl]propanoic acid (PubChem CID 139480419) has the molecular formula C21H20ClFO3 and a molecular weight of 374.84 g/mol. Its IUPAC name is 3-[2-chloro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-chloro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139480419 |
| Molecular Formula | C21H20ClFO3 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-[2-chloro-4-[[2-(4-fluorophenyl)cyclopenten-1-yl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC2=C(c3ccc(F)cc3)CCC2)cc1Cl |
| InChI | InChI=1S/C21H20ClFO3/c22-20-12-18(10-6-15(20)7-11-21(24)25)26-13-16-2-1-3-19(16)14-4-8-17(23)9-5-14/h4-6,8-10,12H,1-3,7,11,13H2,(H,24,25) |
| InChIKey | FWXFONAQGFHVNZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |